C16H21F2N5O — CID 118945684
3-(2,2-difluoroethylamino)-N-ethyl-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)propanamide (PubChem CID 118945684) has the molecular formula C16H21F2N5O and a molecular weight of 337.37 g/mol. Its IUPAC name is 3-(2,2-difluoroethylamino)-N-ethyl-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)propanamide.
| Compound Name | 3-(2,2-difluoroethylamino)-N-ethyl-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 118945684 |
| Molecular Formula | C16H21F2N5O |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 3-(2,2-difluoroethylamino)-N-ethyl-N-(3-methyl-1-pyridin-3-ylpyrazol-4-yl)propanamide |
| SMILES | CCN(C(=O)CCNCC(F)F)c1cn(-c2cccnc2)nc1C |
| InChI | InChI=1S/C16H21F2N5O/c1-3-22(16(24)6-8-20-10-15(17)18)14-11-23(21-12(14)2)13-5-4-7-19-9-13/h4-5,7,9,11,15,20H,3,6,8,10H2,1-2H3 |
| InChIKey | PVEDOQHMLZKKIG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|