C18H25F3N4O2S — CID 146840188
1-[methyl-(3-propyl-1-pyridin-3-ylpyrazol-4-yl)amino]-3-(3,3,3-trifluoropropylsulfinyl)propan-1-ol (PubChem CID 146840188) has the molecular formula C18H25F3N4O2S and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-[methyl-(3-propyl-1-pyridin-3-ylpyrazol-4-yl)amino]-3-(3,3,3-trifluoropropylsulfinyl)propan-1-ol.
| Compound Name | 1-[methyl-(3-propyl-1-pyridin-3-ylpyrazol-4-yl)amino]-3-(3,3,3-trifluoropropylsulfinyl)propan-1-ol |
|---|---|
| PubChem CID | 146840188 |
| Molecular Formula | C18H25F3N4O2S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 1-[methyl-(3-propyl-1-pyridin-3-ylpyrazol-4-yl)amino]-3-(3,3,3-trifluoropropylsulfinyl)propan-1-ol |
| SMILES | CCCc1nn(-c2cccnc2)cc1N(C)C(O)CCS(=O)CCC(F)(F)F |
| InChI | InChI=1S/C18H25F3N4O2S/c1-3-5-15-16(13-25(23-15)14-6-4-9-22-12-14)24(2)17(26)7-10-28(27)11-8-18(19,20)21/h4,6,9,12-13,17,26H,3,5,7-8,10-11H2,1-2H3 |
| InChIKey | SFZGLVCFPWZJGI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|