C16H20ClF3N4O3S — CID 134302526
1-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-3-(3,3,3-trifluoropropylsulfonyl)propan-1-ol (PubChem CID 134302526) has the molecular formula C16H20ClF3N4O3S and a molecular weight of 440.88 g/mol. Its IUPAC name is 1-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-3-(3,3,3-trifluoropropylsulfonyl)propan-1-ol.
| Compound Name | 1-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-3-(3,3,3-trifluoropropylsulfonyl)propan-1-ol |
|---|---|
| PubChem CID | 134302526 |
| Molecular Formula | C16H20ClF3N4O3S |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-3-(3,3,3-trifluoropropylsulfonyl)propan-1-ol |
| SMILES | CCN(c1cn(-c2cccnc2)nc1Cl)C(O)CCS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C16H20ClF3N4O3S/c1-2-23(14(25)5-8-28(26,27)9-6-16(18,19)20)13-11-24(22-15(13)17)12-4-3-7-21-10-12/h3-4,7,10-11,14,25H,2,5-6,8-9H2,1H3 |
| InChIKey | KCBLILOBKMSUEL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|