C18H23F3N4O3S — CID 118022468
N-ethyl-2-methyl-N-[3-methyl-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-3-(3,3,3-trifluoropropylsulfinyl)propanamide (PubChem CID 118022468) has the molecular formula C18H23F3N4O3S and a molecular weight of 432.47 g/mol. Its IUPAC name is N-ethyl-2-methyl-N-[3-methyl-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-3-(3,3,3-trifluoropropylsulfinyl)propanamide.
| Compound Name | N-ethyl-2-methyl-N-[3-methyl-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-3-(3,3,3-trifluoropropylsulfinyl)propanamide |
|---|---|
| PubChem CID | 118022468 |
| Molecular Formula | C18H23F3N4O3S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-ethyl-2-methyl-N-[3-methyl-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-3-(3,3,3-trifluoropropylsulfinyl)propanamide |
| SMILES | CCN(C(=O)C(C)CS(=O)CCC(F)(F)F)c1cn(-c2ccc[n+]([O-])c2)nc1C |
| InChI | InChI=1S/C18H23F3N4O3S/c1-4-24(17(26)13(2)12-29(28)9-7-18(19,20)21)16-11-25(22-14(16)3)15-6-5-8-23(27)10-15/h5-6,8,10-11,13H,4,7,9,12H2,1-3H3 |
| InChIKey | DNUPSIDKJBUWJP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|