C17H20ClF3N4O4S — CID 118026968
N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methyl-3-(3,3,3-trifluoropropylsulfonyl)propanamide (PubChem CID 118026968) has the molecular formula C17H20ClF3N4O4S and a molecular weight of 468.89 g/mol. Its IUPAC name is N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methyl-3-(3,3,3-trifluoropropylsulfonyl)propanamide.
| Compound Name | N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methyl-3-(3,3,3-trifluoropropylsulfonyl)propanamide |
|---|---|
| PubChem CID | 118026968 |
| Molecular Formula | C17H20ClF3N4O4S |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methyl-3-(3,3,3-trifluoropropylsulfonyl)propanamide |
| SMILES | CCN(C(=O)C(C)CS(=O)(=O)CCC(F)(F)F)c1cn(-c2ccc[n+]([O-])c2)nc1Cl |
| InChI | InChI=1S/C17H20ClF3N4O4S/c1-3-24(16(26)12(2)11-30(28,29)8-6-17(19,20)21)14-10-25(22-15(14)18)13-5-4-7-23(27)9-13/h4-5,7,9-10,12H,3,6,8,11H2,1-2H3 |
| InChIKey | HPSUDKPNPBLTJE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|