C16H18ClF3N4O4S — CID 118026976
N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-methyl-3-(4,4,4-trifluorobutylsulfonyl)propanamide (PubChem CID 118026976) has the molecular formula C16H18ClF3N4O4S and a molecular weight of 454.86 g/mol. Its IUPAC name is N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-methyl-3-(4,4,4-trifluorobutylsulfonyl)propanamide.
| Compound Name | N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-methyl-3-(4,4,4-trifluorobutylsulfonyl)propanamide |
|---|---|
| PubChem CID | 118026976 |
| Molecular Formula | C16H18ClF3N4O4S |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-methyl-3-(4,4,4-trifluorobutylsulfonyl)propanamide |
| SMILES | CN(C(=O)CCS(=O)(=O)CCCC(F)(F)F)c1cn(-c2ccc[n+]([O-])c2)nc1Cl |
| InChI | InChI=1S/C16H18ClF3N4O4S/c1-22(14(25)5-9-29(27,28)8-3-6-16(18,19)20)13-11-24(21-15(13)17)12-4-2-7-23(26)10-12/h2,4,7,10-11H,3,5-6,8-9H2,1H3 |
| InChIKey | ZDWRQBONNXEGGO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|