C16H18ClF3N4O2S2 — CID 141451030
N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(3,3,3-trifluoropropyldisulfanyl)propanamide (PubChem CID 141451030) has the molecular formula C16H18ClF3N4O2S2 and a molecular weight of 454.93 g/mol. Its IUPAC name is N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(3,3,3-trifluoropropyldisulfanyl)propanamide.
| Compound Name | N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(3,3,3-trifluoropropyldisulfanyl)propanamide |
|---|---|
| PubChem CID | 141451030 |
| Molecular Formula | C16H18ClF3N4O2S2 |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | N-[3-chloro-1-(1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(3,3,3-trifluoropropyldisulfanyl)propanamide |
| SMILES | CCN(C(=O)CCSSCCC(F)(F)F)c1cn(-c2ccc[n+]([O-])c2)nc1Cl |
| InChI | InChI=1S/C16H18ClF3N4O2S2/c1-2-23(14(25)5-8-27-28-9-6-16(18,19)20)13-11-24(21-15(13)17)12-4-3-7-22(26)10-12/h3-4,7,10-11H,2,5-6,8-9H2,1H3 |
| InChIKey | PWAHIVCJRQWUOP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|