C13H16ClN4O4S+ — CID 123561075
N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methylsulfonylacetamide (PubChem CID 123561075) has the molecular formula C13H16ClN4O4S+ and a molecular weight of 359.82 g/mol. Its IUPAC name is N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methylsulfonylacetamide.
| Compound Name | N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 123561075 |
| Molecular Formula | C13H16ClN4O4S+ |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-2-methylsulfonylacetamide |
| SMILES | CCN(C(=O)CS(C)(=O)=O)c1cn(-c2ccc[n+](O)c2)nc1Cl |
| InChI | InChI=1S/C13H16ClN4O4S/c1-3-17(12(19)9-23(2,21)22)11-8-18(15-13(11)14)10-5-4-6-16(20)7-10/h4-8,20H,3,9H2,1-2H3/q+1 |
| InChIKey | ZUUHETIFSSUUQG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|