C18H23F2N4O3S+ — CID 118028253
3-[(2,2-difluorocyclopropyl)methylsulfinyl]-N-ethyl-N-[1-(1-hydroxypyridin-1-ium-3-yl)-3-methylpyrazol-4-yl]propanamide (PubChem CID 118028253) has the molecular formula C18H23F2N4O3S+ and a molecular weight of 413.47 g/mol. Its IUPAC name is 3-[(2,2-difluorocyclopropyl)methylsulfinyl]-N-ethyl-N-[1-(1-hydroxypyridin-1-ium-3-yl)-3-methylpyrazol-4-yl]propanamide.
| Compound Name | 3-[(2,2-difluorocyclopropyl)methylsulfinyl]-N-ethyl-N-[1-(1-hydroxypyridin-1-ium-3-yl)-3-methylpyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 118028253 |
| Molecular Formula | C18H23F2N4O3S+ |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 3-[(2,2-difluorocyclopropyl)methylsulfinyl]-N-ethyl-N-[1-(1-hydroxypyridin-1-ium-3-yl)-3-methylpyrazol-4-yl]propanamide |
| SMILES | CCN(C(=O)CCS(=O)CC1CC1(F)F)c1cn(-c2ccc[n+](O)c2)nc1C |
| InChI | InChI=1S/C18H23F2N4O3S/c1-3-23(17(25)6-8-28(27)12-14-9-18(14,19)20)16-11-24(21-13(16)2)15-5-4-7-22(26)10-15/h4-5,7,10-11,14,26H,3,6,8-9,12H2,1-2H3/q+1 |
| InChIKey | HAECAUAJMDQUOG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|