C17H17ClF3N3O3S2 — CID 118032620
N-[4-chloro-2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-3-[(2,2-difluorocyclopropyl)methylsulfinyl]-N-ethylpropanamide (PubChem CID 118032620) has the molecular formula C17H17ClF3N3O3S2 and a molecular weight of 467.92 g/mol. Its IUPAC name is N-[4-chloro-2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-3-[(2,2-difluorocyclopropyl)methylsulfinyl]-N-ethylpropanamide.
| Compound Name | N-[4-chloro-2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-3-[(2,2-difluorocyclopropyl)methylsulfinyl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 118032620 |
| Molecular Formula | C17H17ClF3N3O3S2 |
| Molecular Weight | 467.92 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | N-[4-chloro-2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-3-[(2,2-difluorocyclopropyl)methylsulfinyl]-N-ethylpropanamide |
| SMILES | CCN(C(=O)CCS(=O)CC1CC1(F)F)c1sc(-c2cc(F)c[n+]([O-])c2)nc1Cl |
| InChI | InChI=1S/C17H17ClF3N3O3S2/c1-2-24(13(25)3-4-29(27)9-11-6-17(11,20)21)16-14(18)22-15(28-16)10-5-12(19)8-23(26)7-10/h5,7-8,11H,2-4,6,9H2,1H3 |
| InChIKey | CTPWTUWDYAYLBX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 77.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|