C13H14ClN3O3S2 — CID 118032538
N-[4-chloro-2-(1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-methyl-3-methylsulfinylpropanamide (PubChem CID 118032538) has the molecular formula C13H14ClN3O3S2 and a molecular weight of 359.86 g/mol. Its IUPAC name is N-[4-chloro-2-(1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-methyl-3-methylsulfinylpropanamide.
| Compound Name | N-[4-chloro-2-(1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-methyl-3-methylsulfinylpropanamide |
|---|---|
| PubChem CID | 118032538 |
| Molecular Formula | C13H14ClN3O3S2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | N-[4-chloro-2-(1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-methyl-3-methylsulfinylpropanamide |
| SMILES | CN(C(=O)CCS(C)=O)c1sc(-c2ccc[n+]([O-])c2)nc1Cl |
| InChI | InChI=1S/C13H14ClN3O3S2/c1-16(10(18)5-7-22(2)20)13-11(14)15-12(21-13)9-4-3-6-17(19)8-9/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | ZZSJKZPEBBATEM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 77.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|