C16H17ClN3O4S2+ — CID 123283970
N-[4-chloro-2-(1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-2-methyl-3-methylsulfonyl-N-prop-2-ynylpropanamide (PubChem CID 123283970) has the molecular formula C16H17ClN3O4S2+ and a molecular weight of 414.92 g/mol. Its IUPAC name is N-[4-chloro-2-(1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-2-methyl-3-methylsulfonyl-N-prop-2-ynylpropanamide.
| Compound Name | N-[4-chloro-2-(1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-2-methyl-3-methylsulfonyl-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 123283970 |
| Molecular Formula | C16H17ClN3O4S2+ |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | N-[4-chloro-2-(1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-2-methyl-3-methylsulfonyl-N-prop-2-ynylpropanamide |
| SMILES | C#CCN(C(=O)C(C)CS(C)(=O)=O)c1sc(-c2ccc[n+](O)c2)nc1Cl |
| InChI | InChI=1S/C16H17ClN3O4S2/c1-4-7-20(15(21)11(2)10-26(3,23)24)16-13(17)18-14(25-16)12-6-5-8-19(22)9-12/h1,5-6,8-9,11,22H,7,10H2,2-3H3/q+1 |
| InChIKey | RRUNPUXFPDXNRW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|