C14H16ClN3OS3 — CID 118032556
N-[4-chloro-2-(1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-ethyl-3-methylsulfanylpropanethioamide (PubChem CID 118032556) has the molecular formula C14H16ClN3OS3 and a molecular weight of 373.96 g/mol. Its IUPAC name is N-[4-chloro-2-(1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-ethyl-3-methylsulfanylpropanethioamide.
| Compound Name | N-[4-chloro-2-(1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-ethyl-3-methylsulfanylpropanethioamide |
|---|---|
| PubChem CID | 118032556 |
| Molecular Formula | C14H16ClN3OS3 |
| Molecular Weight | 373.96 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | N-[4-chloro-2-(1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-ethyl-3-methylsulfanylpropanethioamide |
| SMILES | CCN(C(=S)CCSC)c1sc(-c2ccc[n+]([O-])c2)nc1Cl |
| InChI | InChI=1S/C14H16ClN3OS3/c1-3-18(11(20)6-8-21-2)14-12(15)16-13(22-14)10-5-4-7-17(19)9-10/h4-5,7,9H,3,6,8H2,1-2H3 |
| InChIKey | OEPCACDTOZJGRE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.96 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|