C16H18ClF3N3O3S2+ — CID 118043600
N-[4-chloro-2-(1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-methyl-3-(4,4,4-trifluorobutylsulfinyl)propanamide (PubChem CID 118043600) has the molecular formula C16H18ClF3N3O3S2+ and a molecular weight of 456.92 g/mol. Its IUPAC name is N-[4-chloro-2-(1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-methyl-3-(4,4,4-trifluorobutylsulfinyl)propanamide.
| Compound Name | N-[4-chloro-2-(1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-methyl-3-(4,4,4-trifluorobutylsulfinyl)propanamide |
|---|---|
| PubChem CID | 118043600 |
| Molecular Formula | C16H18ClF3N3O3S2+ |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | N-[4-chloro-2-(1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-methyl-3-(4,4,4-trifluorobutylsulfinyl)propanamide |
| SMILES | CN(C(=O)CCS(=O)CCCC(F)(F)F)c1sc(-c2ccc[n+](O)c2)nc1Cl |
| InChI | InChI=1S/C16H18ClF3N3O3S2/c1-22(12(24)5-9-28(26)8-3-6-16(18,19)20)15-13(17)21-14(27-15)11-4-2-7-23(25)10-11/h2,4,7,10,25H,3,5-6,8-9H2,1H3/q+1 |
| InChIKey | GPAJWIDAGQHUJF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|