C13H16ClN4O3S+ — CID 123292036
N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-methyl-3-methylsulfinylpropanamide (PubChem CID 123292036) has the molecular formula C13H16ClN4O3S+ and a molecular weight of 343.82 g/mol. Its IUPAC name is N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-methyl-3-methylsulfinylpropanamide.
| Compound Name | N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-methyl-3-methylsulfinylpropanamide |
|---|---|
| PubChem CID | 123292036 |
| Molecular Formula | C13H16ClN4O3S+ |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-methyl-3-methylsulfinylpropanamide |
| SMILES | CN(C(=O)CCS(C)=O)c1cn(-c2ccc[n+](O)c2)nc1Cl |
| InChI | InChI=1S/C13H16ClN4O3S/c1-16(12(19)5-7-22(2)21)11-9-18(15-13(11)14)10-4-3-6-17(20)8-10/h3-4,6,8-9,20H,5,7H2,1-2H3/q+1 |
| InChIKey | XCVWXRRJLWFEOS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|