C17H21ClF3N4O2S+ — CID 118027967
N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(4,4,4-trifluorobutylsulfanyl)propanamide (PubChem CID 118027967) has the molecular formula C17H21ClF3N4O2S+ and a molecular weight of 437.90 g/mol. Its IUPAC name is N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(4,4,4-trifluorobutylsulfanyl)propanamide.
| Compound Name | N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(4,4,4-trifluorobutylsulfanyl)propanamide |
|---|---|
| PubChem CID | 118027967 |
| Molecular Formula | C17H21ClF3N4O2S+ |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[3-chloro-1-(1-hydroxypyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(4,4,4-trifluorobutylsulfanyl)propanamide |
| SMILES | CCN(C(=O)CCSCCCC(F)(F)F)c1cn(-c2ccc[n+](O)c2)nc1Cl |
| InChI | InChI=1S/C17H21ClF3N4O2S/c1-2-24(15(26)6-10-28-9-4-7-17(19,20)21)14-12-25(22-16(14)18)13-5-3-8-23(27)11-13/h3,5,8,11-12,27H,2,4,6-7,9-10H2,1H3/q+1 |
| InChIKey | NHTJFNOZGZZMKU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|