C15H15ClF4N4O2S — CID 118026997
N-[3-chloro-1-(5-fluoro-1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(2,2,2-trifluoroethylsulfanyl)propanamide (PubChem CID 118026997) has the molecular formula C15H15ClF4N4O2S and a molecular weight of 426.82 g/mol. Its IUPAC name is N-[3-chloro-1-(5-fluoro-1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(2,2,2-trifluoroethylsulfanyl)propanamide.
| Compound Name | N-[3-chloro-1-(5-fluoro-1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(2,2,2-trifluoroethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 118026997 |
| Molecular Formula | C15H15ClF4N4O2S |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | N-[3-chloro-1-(5-fluoro-1-oxidopyridin-1-ium-3-yl)pyrazol-4-yl]-N-ethyl-3-(2,2,2-trifluoroethylsulfanyl)propanamide |
| SMILES | CCN(C(=O)CCSCC(F)(F)F)c1cn(-c2cc(F)c[n+]([O-])c2)nc1Cl |
| InChI | InChI=1S/C15H15ClF4N4O2S/c1-2-23(13(25)3-4-27-9-15(18,19)20)12-8-24(21-14(12)16)11-5-10(17)6-22(26)7-11/h5-8H,2-4,9H2,1H3 |
| InChIKey | SSJHCVLQLYXGSN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|