C18H20ClF2N3OS — CID 130439422
N-(3-chloro-1-phenylpyrazol-4-yl)-3-(4,4-difluorobut-3-enylsulfanyl)-N-ethylpropanamide (PubChem CID 130439422) has the molecular formula C18H20ClF2N3OS and a molecular weight of 399.89 g/mol. Its IUPAC name is N-(3-chloro-1-phenylpyrazol-4-yl)-3-(4,4-difluorobut-3-enylsulfanyl)-N-ethylpropanamide.
| Compound Name | N-(3-chloro-1-phenylpyrazol-4-yl)-3-(4,4-difluorobut-3-enylsulfanyl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 130439422 |
| Molecular Formula | C18H20ClF2N3OS |
| Molecular Weight | 399.89 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N-(3-chloro-1-phenylpyrazol-4-yl)-3-(4,4-difluorobut-3-enylsulfanyl)-N-ethylpropanamide |
| SMILES | CCN(C(=O)CCSCCC=C(F)F)c1cn(-c2ccccc2)nc1Cl |
| InChI | InChI=1S/C18H20ClF2N3OS/c1-2-23(17(25)10-12-26-11-6-9-16(20)21)15-13-24(22-18(15)19)14-7-4-3-5-8-14/h3-5,7-9,13H,2,6,10-12H2,1H3 |
| InChIKey | PSANXGWVUVXHNG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|