C18H22ClF3N3O2S2+ — CID 118043606
N-[4-chloro-2-(5-fluoro-1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-3-(4,4-difluoropentylsulfanyl)-N-ethylpropanamide (PubChem CID 118043606) has the molecular formula C18H22ClF3N3O2S2+ and a molecular weight of 468.97 g/mol. Its IUPAC name is N-[4-chloro-2-(5-fluoro-1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-3-(4,4-difluoropentylsulfanyl)-N-ethylpropanamide.
| Compound Name | N-[4-chloro-2-(5-fluoro-1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-3-(4,4-difluoropentylsulfanyl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 118043606 |
| Molecular Formula | C18H22ClF3N3O2S2+ |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N-[4-chloro-2-(5-fluoro-1-hydroxypyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-3-(4,4-difluoropentylsulfanyl)-N-ethylpropanamide |
| SMILES | CCN(C(=O)CCSCCCC(C)(F)F)c1sc(-c2cc(F)c[n+](O)c2)nc1Cl |
| InChI | InChI=1S/C18H22ClF3N3O2S2/c1-3-25(14(26)5-8-28-7-4-6-18(2,21)22)17-15(19)23-16(29-17)12-9-13(20)11-24(27)10-12/h9-11,27H,3-8H2,1-2H3/q+1 |
| InChIKey | XZGVXTHAEAWVAP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|