C15H17ClFN3O3S2 — CID 118032569
N-[4-chloro-2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-ethyl-2-methyl-3-methylsulfinylpropanamide (PubChem CID 118032569) has the molecular formula C15H17ClFN3O3S2 and a molecular weight of 405.90 g/mol. Its IUPAC name is N-[4-chloro-2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-ethyl-2-methyl-3-methylsulfinylpropanamide.
| Compound Name | N-[4-chloro-2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-ethyl-2-methyl-3-methylsulfinylpropanamide |
|---|---|
| PubChem CID | 118032569 |
| Molecular Formula | C15H17ClFN3O3S2 |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | N-[4-chloro-2-(5-fluoro-1-oxidopyridin-1-ium-3-yl)-1,3-thiazol-5-yl]-N-ethyl-2-methyl-3-methylsulfinylpropanamide |
| SMILES | CCN(C(=O)C(C)CS(C)=O)c1sc(-c2cc(F)c[n+]([O-])c2)nc1Cl |
| InChI | InChI=1S/C15H17ClFN3O3S2/c1-4-20(14(21)9(2)8-25(3)23)15-12(16)18-13(24-15)10-5-11(17)7-19(22)6-10/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | YUMIBTZNZVKLPL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|