C28H31ClN4O2S — CID 167604496
3-(1-aminoisoquinolin-6-yl)-1-[4-chloro-5-[(4-piperazin-1-ylphenoxy)methyl]thiophen-2-yl]propan-1-one;methane (PubChem CID 167604496) has the molecular formula C28H31ClN4O2S and a molecular weight of 523.10 g/mol. Its IUPAC name is 3-(1-aminoisoquinolin-6-yl)-1-[4-chloro-5-[(4-piperazin-1-ylphenoxy)methyl]thiophen-2-yl]propan-1-one;methane.
| Compound Name | 3-(1-aminoisoquinolin-6-yl)-1-[4-chloro-5-[(4-piperazin-1-ylphenoxy)methyl]thiophen-2-yl]propan-1-one;methane |
|---|---|
| PubChem CID | 167604496 |
| Molecular Formula | C28H31ClN4O2S |
| Molecular Weight | 523.10 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 3-(1-aminoisoquinolin-6-yl)-1-[4-chloro-5-[(4-piperazin-1-ylphenoxy)methyl]thiophen-2-yl]propan-1-one;methane |
| SMILES | C.Nc1nccc2cc(CCC(=O)c3cc(Cl)c(COc4ccc(N5CCNCC5)cc4)s3)ccc12 |
| InChI | InChI=1S/C27H27ClN4O2S.CH4/c28-23-16-25(24(33)8-2-18-1-7-22-19(15-18)9-10-31-27(22)29)35-26(23)17-34-21-5-3-20(4-6-21)32-13-11-30-12-14-32;/h1,3-7,9-10,15-16,30H,2,8,11-14,17H2,(H2,29,31);1H4 |
| InChIKey | KERKVOJJWLPPBJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.10 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|