C23H36O3 — CID 167605305
ethyl (E)-2-methyl-3-(3-propyl-1-bicyclo[1.1.1]pentanyl)prop-2-enoate;3-propylbicyclo[1.1.1]pentane-1-carbaldehyde (PubChem CID 167605305) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is ethyl (E)-2-methyl-3-(3-propyl-1-bicyclo[1.1.1]pentanyl)prop-2-enoate;3-propylbicyclo[1.1.1]pentane-1-carbaldehyde.
| Compound Name | ethyl (E)-2-methyl-3-(3-propyl-1-bicyclo[1.1.1]pentanyl)prop-2-enoate;3-propylbicyclo[1.1.1]pentane-1-carbaldehyde |
|---|---|
| PubChem CID | 167605305 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | ethyl (E)-2-methyl-3-(3-propyl-1-bicyclo[1.1.1]pentanyl)prop-2-enoate;3-propylbicyclo[1.1.1]pentane-1-carbaldehyde |
| SMILES | CCCC12CC(/C=C(\C)C(=O)OCC)(C1)C2.CCCC12CC(C=O)(C1)C2 |
| InChI | InChI=1S/C14H22O2.C9H14O/c1-4-6-13-8-14(9-13,10-13)7-11(3)12(15)16-5-2;1-2-3-8-4-9(5-8,6-8)7-10/h7H,4-6,8-10H2,1-3H3;7H,2-6H2,1H3/b11-7+; |
| InChIKey | KHLNIPQAZNFPKR-RVDQCCQOSA-N |
| XLogP | 5.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|