C8H10N6 — CID 167606702
1H-imidazole-5-carbonitrile;1H-imidazol-5-ylmethanamine (PubChem CID 167606702) has the molecular formula C8H10N6 and a molecular weight of 190.21 g/mol. Its IUPAC name is 1H-imidazole-5-carbonitrile;1H-imidazol-5-ylmethanamine.
| Compound Name | 1H-imidazole-5-carbonitrile;1H-imidazol-5-ylmethanamine |
|---|---|
| PubChem CID | 167606702 |
| Molecular Formula | C8H10N6 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1H-imidazole-5-carbonitrile;1H-imidazol-5-ylmethanamine |
| SMILES | N#Cc1cnc[nH]1.NCc1cnc[nH]1 |
| InChI | InChI=1S/C4H7N3.C4H3N3/c2*5-1-4-2-6-3-7-4/h2-3H,1,5H2,(H,6,7);2-3H,(H,6,7) |
| InChIKey | KMELYOAQYWNRAU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |