C20H36F6O9 — CID 167608002
1-[2-[[1,1-difluoro-2-[2-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]ethoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]hexan-2-ol (PubChem CID 167608002) has the molecular formula C20H36F6O9 and a molecular weight of 534.49 g/mol. Its IUPAC name is 1-[2-[[1,1-difluoro-2-[2-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]ethoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]hexan-2-ol.
| Compound Name | 1-[2-[[1,1-difluoro-2-[2-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]ethoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]hexan-2-ol |
|---|---|
| PubChem CID | 167608002 |
| Molecular Formula | C20H36F6O9 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 1-[2-[[1,1-difluoro-2-[2-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]ethoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]hexan-2-ol |
| SMILES | CCCCC(O)COCC(F)(F)OC(F)(F)OC(F)(F)COCCOCC(O)COCCCCO |
| InChI | InChI=1S/C20H36F6O9/c1-2-3-6-16(28)11-33-15-19(23,24)35-20(25,26)34-18(21,22)14-32-10-9-31-13-17(29)12-30-8-5-4-7-27/h16-17,27-29H,2-15H2,1H3 |
| InChIKey | PDBIERAOEXTJJQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|