About carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate
carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate (PubChem CID 167608453) has the molecular formula C10H16BrN3OS
and a molecular weight of 306.23 g/mol. Its IUPAC name is carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate.
Molecular Properties
| Compound Name | carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate |
| PubChem CID | 167608453 |
| Molecular Formula | C10H16BrN3OS |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate |
| SMILES | [H]/N=C(\Br)S/C(=N\[H])N1CCC(CC(C)=O)CC1 |
| InChI | InChI=1S/C10H16BrN3OS/c1-7(15)6-8-2-4-14(5-3-8)10(13)16-9(11)12/h8,12-13H,2-6H2,1H3/b12-9+,13-10- |
| InChIKey | JFDCEBDZARBMIN-FMYPVGJQSA-N |
| XLogP | 2.68 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate?
The IUPAC name of carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate (CID 167608453) is carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate.
What is the SMILES notation for carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate?
The canonical SMILES for carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate is [H]/N=C(\Br)S/C(=N\[H])N1CCC(CC(C)=O)CC1.
What is the InChIKey of carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate?
The InChIKey is JFDCEBDZARBMIN-FMYPVGJQSA-N. The full InChI is InChI=1S/C10H16BrN3OS/c1-7(15)6-8-2-4-14(5-3-8)10(13)16-9(11)12/h8,12-13H,2-6H2,1H3/b12-9+,13-10-.
What are the key properties of carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate?
carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate has a molecular weight of 306.23 g/mol, XLogP of 2.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonobromidimidoyl 4-(2-oxopropyl)piperidine-1-carboximidothioate is sourced from PubChem (CID 167608453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).