C29H32FN7OS — CID 167614657
4-[4-(3-azabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-1,3-benzothiazol-2-amine (PubChem CID 167614657) has the molecular formula C29H32FN7OS and a molecular weight of 545.69 g/mol. Its IUPAC name is 4-[4-(3-azabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 4-[4-(3-azabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 167614657 |
| Molecular Formula | C29H32FN7OS |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 4-[4-(3-azabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2c(-c3ncc4c(N5CC6CCC(C6)C5)nc(OCC56CCCN5CCC6)nc4c3F)cccc2s1 |
| InChI | InChI=1S/C29H32FN7OS/c30-22-24(19-4-1-5-21-23(19)33-27(31)39-21)32-13-20-25(22)34-28(38-16-29-8-2-10-37(29)11-3-9-29)35-26(20)36-14-17-6-7-18(12-17)15-36/h1,4-5,13,17-18H,2-3,6-12,14-16H2,(H2,31,33) |
| InChIKey | AFGALMRUIKPOLA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |