C27H29N3OS — CID 16761885
N-[2-[butylamino(phenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridin-3-yl]benzamide (PubChem CID 16761885) has the molecular formula C27H29N3OS and a molecular weight of 443.62 g/mol. Its IUPAC name is N-[2-[butylamino(phenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridin-3-yl]benzamide.
| Compound Name | N-[2-[butylamino(phenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 16761885 |
| Molecular Formula | C27H29N3OS |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-[2-[butylamino(phenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridin-3-yl]benzamide |
| SMILES | CCCCNC(c1ccccc1)c1sc2nc(C)cc(C)c2c1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H29N3OS/c1-4-5-16-28-23(20-12-8-6-9-13-20)25-24(30-26(31)21-14-10-7-11-15-21)22-18(2)17-19(3)29-27(22)32-25/h6-15,17,23,28H,4-5,16H2,1-3H3,(H,30,31) |
| InChIKey | QFPROSYDZYVJDI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|