C15H28F2N2O — CID 167619773
cyclohexanone;3-(3,3-difluoroazetidin-1-yl)piperidine;methane (PubChem CID 167619773) has the molecular formula C15H28F2N2O and a molecular weight of 290.40 g/mol. Its IUPAC name is cyclohexanone;3-(3,3-difluoroazetidin-1-yl)piperidine;methane.
| Compound Name | cyclohexanone;3-(3,3-difluoroazetidin-1-yl)piperidine;methane |
|---|---|
| PubChem CID | 167619773 |
| Molecular Formula | C15H28F2N2O |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | cyclohexanone;3-(3,3-difluoroazetidin-1-yl)piperidine;methane |
| SMILES | C.FC1(F)CN(C2CCCNC2)C1.O=C1CCCCC1 |
| InChI | InChI=1S/C8H14F2N2.C6H10O.CH4/c9-8(10)5-12(6-8)7-2-1-3-11-4-7;7-6-4-2-1-3-5-6;/h7,11H,1-6H2;1-5H2;1H4 |
| InChIKey | MGSRTAIMKOTMQT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |