C17H27N — CID 167620076
2-tert-butyl-3aH-indole;2,2-dimethylpropane (PubChem CID 167620076) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 2-tert-butyl-3aH-indole;2,2-dimethylpropane.
| Compound Name | 2-tert-butyl-3aH-indole;2,2-dimethylpropane |
|---|---|
| PubChem CID | 167620076 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 2-tert-butyl-3aH-indole;2,2-dimethylpropane |
| SMILES | CC(C)(C)C.CC(C)(C)C1=CC2C=CC=CC2=N1 |
| InChI | InChI=1S/C12H15N.C5H12/c1-12(2,3)11-8-9-6-4-5-7-10(9)13-11;1-5(2,3)4/h4-9H,1-3H3;1-4H3 |
| InChIKey | MHVNDYUNZVIIGZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |