C17H30N2O2 — CID 16762046
2-[4-[3-(2,6,6-trimethyloxan-2-yl)prop-2-ynyl]piperazin-1-yl]ethanol (PubChem CID 16762046) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-[4-[3-(2,6,6-trimethyloxan-2-yl)prop-2-ynyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[3-(2,6,6-trimethyloxan-2-yl)prop-2-ynyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 16762046 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 2-[4-[3-(2,6,6-trimethyloxan-2-yl)prop-2-ynyl]piperazin-1-yl]ethanol |
| SMILES | CC1(C)CCCC(C)(C#CCN2CCN(CCO)CC2)O1 |
| InChI | InChI=1S/C17H30N2O2/c1-16(2)6-4-7-17(3,21-16)8-5-9-18-10-12-19(13-11-18)14-15-20/h20H,4,6-7,9-15H2,1-3H3 |
| InChIKey | IERCSOVXSKMBJS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|