C21H25N5O — CID 167620641
N-[(5-aminonaphthalen-2-yl)methyl]-5-(1-methylpiperidin-4-yl)oxypyrazin-2-amine (PubChem CID 167620641) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is N-[(5-aminonaphthalen-2-yl)methyl]-5-(1-methylpiperidin-4-yl)oxypyrazin-2-amine.
| Compound Name | N-[(5-aminonaphthalen-2-yl)methyl]-5-(1-methylpiperidin-4-yl)oxypyrazin-2-amine |
|---|---|
| PubChem CID | 167620641 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-[(5-aminonaphthalen-2-yl)methyl]-5-(1-methylpiperidin-4-yl)oxypyrazin-2-amine |
| SMILES | CN1CCC(Oc2cnc(NCc3ccc4c(N)cccc4c3)cn2)CC1 |
| InChI | InChI=1S/C21H25N5O/c1-26-9-7-17(8-10-26)27-21-14-24-20(13-25-21)23-12-15-5-6-18-16(11-15)3-2-4-19(18)22/h2-6,11,13-14,17H,7-10,12,22H2,1H3,(H,23,24) |
| InChIKey | CIVQISRVKFXXPY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|