C28H36N4O2 — CID 167622489
3-cyclopropyl-4-[3-(6-methylheptanoyl)anilino]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide (PubChem CID 167622489) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 3-cyclopropyl-4-[3-(6-methylheptanoyl)anilino]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide.
| Compound Name | 3-cyclopropyl-4-[3-(6-methylheptanoyl)anilino]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide |
|---|---|
| PubChem CID | 167622489 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 3-cyclopropyl-4-[3-(6-methylheptanoyl)anilino]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)benzamide |
| SMILES | CC(C)CCCCC(=O)c1cccc(Nc2ccc(C(=O)NC3=NCCCN3)cc2C2CC2)c1 |
| InChI | InChI=1S/C28H36N4O2/c1-19(2)7-3-4-10-26(33)21-8-5-9-23(17-21)31-25-14-13-22(18-24(25)20-11-12-20)27(34)32-28-29-15-6-16-30-28/h5,8-9,13-14,17-20,31H,3-4,6-7,10-12,15-16H2,1-2H3,(H2,29,30,32,34) |
| InChIKey | MQGGYEIFDGTYKW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|