C18H20N2O6S — CID 167623126
3,4-dihydroxy-7-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-5-oxocyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 167623126) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is 3,4-dihydroxy-7-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-5-oxocyclohepta-1,3,6-triene-1-carboxamide.
| Compound Name | 3,4-dihydroxy-7-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-5-oxocyclohepta-1,3,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 167623126 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3,4-dihydroxy-7-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-5-oxocyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)c2cc(O)c(O)c(=O)cc2C)cc1 |
| InChI | InChI=1S/C18H20N2O6S/c1-11-3-5-13(6-4-11)27(25,26)20-8-7-19-18(24)14-10-16(22)17(23)15(21)9-12(14)2/h3-6,9-10,20H,7-8H2,1-2H3,(H,19,24)(H2,21,22,23) |
| InChIKey | TVYHKQARTDFOCB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|