C6H9ClN2S — CID 16762381
2-(5-chloro-4-methyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 16762381) has the molecular formula C6H9ClN2S and a molecular weight of 176.67 g/mol. Its IUPAC name is 2-(5-chloro-4-methyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | 2-(5-chloro-4-methyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 16762381 |
| Molecular Formula | C6H9ClN2S |
| Molecular Weight | 176.67 g/mol |
| Exact Mass | 176.02 |
| IUPAC Name | 2-(5-chloro-4-methyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | Cc1nc(CCN)sc1Cl |
| InChI | InChI=1S/C6H9ClN2S/c1-4-6(7)10-5(9-4)2-3-8/h2-3,8H2,1H3 |
| InChIKey | WHCCFMJFEKJTIZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.67 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |