C10H11ClN2S — CID 39106792
2-(4-chloro-6-methyl-1,3-benzothiazol-2-yl)ethanamine (PubChem CID 39106792) has the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. Its IUPAC name is 2-(4-chloro-6-methyl-1,3-benzothiazol-2-yl)ethanamine.
| Compound Name | 2-(4-chloro-6-methyl-1,3-benzothiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 39106792 |
| Molecular Formula | C10H11ClN2S |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 2-(4-chloro-6-methyl-1,3-benzothiazol-2-yl)ethanamine |
| SMILES | Cc1cc(Cl)c2nc(CCN)sc2c1 |
| InChI | InChI=1S/C10H11ClN2S/c1-6-4-7(11)10-8(5-6)14-9(13-10)2-3-12/h4-5H,2-3,12H2,1H3 |
| InChIKey | XTJSIIJICPOEER-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |