About 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine
2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine (PubChem CID 39107200) has the molecular formula C10H11ClN2OS
and a molecular weight of 242.73 g/mol. Its IUPAC name is 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine |
| PubChem CID | 39107200 |
| Molecular Formula | C10H11ClN2OS |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine |
| SMILES | COc1cc2sc(CCN)nc2cc1Cl |
| InChI | InChI=1S/C10H11ClN2OS/c1-14-8-5-9-7(4-6(8)11)13-10(15-9)2-3-12/h4-5H,2-3,12H2,1H3 |
| InChIKey | XIQPHIBWOXRONA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine?
The IUPAC name of 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine (CID 39107200) is 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine.
What is the SMILES notation for 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine?
The canonical SMILES for 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine is COc1cc2sc(CCN)nc2cc1Cl.
What is the InChIKey of 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine?
The InChIKey is XIQPHIBWOXRONA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2OS/c1-14-8-5-9-7(4-6(8)11)13-10(15-9)2-3-12/h4-5H,2-3,12H2,1H3.
What are the key properties of 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine?
2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine has a molecular weight of 242.73 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine is sourced from PubChem (CID 39107200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).