C10H11ClN2OS — CID 39107200
2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine (PubChem CID 39107200) has the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. Its IUPAC name is 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine.
| Compound Name | 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 39107200 |
| Molecular Formula | C10H11ClN2OS |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2-(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)ethanamine |
| SMILES | COc1cc2sc(CCN)nc2cc1Cl |
| InChI | InChI=1S/C10H11ClN2OS/c1-14-8-5-9-7(4-6(8)11)13-10(15-9)2-3-12/h4-5H,2-3,12H2,1H3 |
| InChIKey | XIQPHIBWOXRONA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |