C38H48N6O5 — CID 167626979
propan-2-yl 2-[5-amino-2-methoxy-4-[5-methyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]anilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate (PubChem CID 167626979) has the molecular formula C38H48N6O5 and a molecular weight of 668.84 g/mol. Its IUPAC name is propan-2-yl 2-[5-amino-2-methoxy-4-[5-methyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]anilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 2-[5-amino-2-methoxy-4-[5-methyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]anilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 167626979 |
| Molecular Formula | C38H48N6O5 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.37 |
| IUPAC Name | propan-2-yl 2-[5-amino-2-methoxy-4-[5-methyl-5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]anilino]-4-(1-methylindol-3-yl)pyrimidine-5-carboxylate |
| SMILES | COc1cc(N2CC3CC(C)(CC(=O)OC(C)(C)C)CC3C2)c(N)cc1Nc1ncc(C(=O)OC(C)C)c(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C38H48N6O5/c1-22(2)48-35(46)26-18-40-36(42-34(26)27-21-43(7)30-12-10-9-11-25(27)30)41-29-13-28(39)31(14-32(29)47-8)44-19-23-15-38(6,16-24(23)20-44)17-33(45)49-37(3,4)5/h9-14,18,21-24H,15-17,19-20,39H2,1-8H3,(H,40,41,42) |
| InChIKey | VNWVHYNIWSTAJV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|