C54H58O4 — CID 167629081
tert-butyl 4-(3,3-dimethylpentoxy)butanoate;octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecayne;2,2,5,5-tetramethylheptan-3-one (PubChem CID 167629081) has the molecular formula C54H58O4 and a molecular weight of 771.05 g/mol. Its IUPAC name is tert-butyl 4-(3,3-dimethylpentoxy)butanoate;octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecayne;2,2,5,5-tetramethylheptan-3-one.
| Compound Name | tert-butyl 4-(3,3-dimethylpentoxy)butanoate;octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecayne;2,2,5,5-tetramethylheptan-3-one |
|---|---|
| PubChem CID | 167629081 |
| Molecular Formula | C54H58O4 |
| Molecular Weight | 771.05 g/mol |
| Exact Mass | 770.43 |
| IUPAC Name | tert-butyl 4-(3,3-dimethylpentoxy)butanoate;octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecayne;2,2,5,5-tetramethylheptan-3-one |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC.CCC(C)(C)CC(=O)C(C)(C)C.CCC(C)(C)CCOCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H6.C15H30O3.C11H22O/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-28-26-24-22-20-18-16-14-12-10-8-6-4-2;1-7-15(5,6)10-12-17-11-8-9-13(16)18-14(2,3)4;1-7-11(5,6)8-9(12)10(2,3)4/h1-2H3;7-12H2,1-6H3;7-8H2,1-6H3 |
| InChIKey | NNJGUOIXSPDWQD-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.05 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|