C22H31NO3 — CID 167629095
1-[4-(7,7-dimethyl-2-oxooctoxy)phenyl]-4-methylidenepiperidin-2-one (PubChem CID 167629095) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 1-[4-(7,7-dimethyl-2-oxooctoxy)phenyl]-4-methylidenepiperidin-2-one.
| Compound Name | 1-[4-(7,7-dimethyl-2-oxooctoxy)phenyl]-4-methylidenepiperidin-2-one |
|---|---|
| PubChem CID | 167629095 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-[4-(7,7-dimethyl-2-oxooctoxy)phenyl]-4-methylidenepiperidin-2-one |
| SMILES | C=C1CCN(c2ccc(OCC(=O)CCCCC(C)(C)C)cc2)C(=O)C1 |
| InChI | InChI=1S/C22H31NO3/c1-17-12-14-23(21(25)15-17)18-8-10-20(11-9-18)26-16-19(24)7-5-6-13-22(2,3)4/h8-11H,1,5-7,12-16H2,2-4H3 |
| InChIKey | AOVINBKFPRAUNM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|