C28H31N2O6PS2 — CID 167633728
[(19S)-10,19-diethyl-14,18-dioxo-7-phosphanyloxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 4-(ethyldisulfanyl)butanoate (PubChem CID 167633728) has the molecular formula C28H31N2O6PS2 and a molecular weight of 586.67 g/mol. Its IUPAC name is [(19S)-10,19-diethyl-14,18-dioxo-7-phosphanyloxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 4-(ethyldisulfanyl)butanoate.
| Compound Name | [(19S)-10,19-diethyl-14,18-dioxo-7-phosphanyloxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 4-(ethyldisulfanyl)butanoate |
|---|---|
| PubChem CID | 167633728 |
| Molecular Formula | C28H31N2O6PS2 |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | [(19S)-10,19-diethyl-14,18-dioxo-7-phosphanyloxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl] 4-(ethyldisulfanyl)butanoate |
| SMILES | CCSSCCCC(=O)O[C@]1(CC)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(OP)cc1c2CC |
| InChI | InChI=1S/C28H31N2O6PS2/c1-4-17-18-12-16(36-37)9-10-22(18)29-25-19(17)14-30-23(25)13-21-20(26(30)32)15-34-27(33)28(21,5-2)35-24(31)8-7-11-39-38-6-3/h9-10,12-13H,4-8,11,14-15,37H2,1-3H3/t28-/m0/s1 |
| InChIKey | SDRSOSWUWXFARC-NDEPHWFRSA-N |
| XLogP | 5.54 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|