C27H31N3O2S — CID 167638379
(Z)-2-methylsulfanyl-N-[3-(2-phenyl-5-propanoylbenzimidazol-1-yl)cyclohexyl]but-2-enamide (PubChem CID 167638379) has the molecular formula C27H31N3O2S and a molecular weight of 461.63 g/mol. Its IUPAC name is (Z)-2-methylsulfanyl-N-[3-(2-phenyl-5-propanoylbenzimidazol-1-yl)cyclohexyl]but-2-enamide.
| Compound Name | (Z)-2-methylsulfanyl-N-[3-(2-phenyl-5-propanoylbenzimidazol-1-yl)cyclohexyl]but-2-enamide |
|---|---|
| PubChem CID | 167638379 |
| Molecular Formula | C27H31N3O2S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (Z)-2-methylsulfanyl-N-[3-(2-phenyl-5-propanoylbenzimidazol-1-yl)cyclohexyl]but-2-enamide |
| SMILES | C/C=C(\SC)C(=O)NC1CCCC(n2c(-c3ccccc3)nc3cc(C(=O)CC)ccc32)C1 |
| InChI | InChI=1S/C27H31N3O2S/c1-4-24(31)19-14-15-23-22(16-19)29-26(18-10-7-6-8-11-18)30(23)21-13-9-12-20(17-21)28-27(32)25(5-2)33-3/h5-8,10-11,14-16,20-21H,4,9,12-13,17H2,1-3H3,(H,28,32)/b25-5- |
| InChIKey | CLWCSNFKCVSFOV-FISMNSNESA-N |
| XLogP | 6.16 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|