About 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol
1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol (PubChem CID 167638393) has the molecular formula C26H23BrN2O4S2
and a molecular weight of 571.52 g/mol. Its IUPAC name is 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol.
Molecular Properties
| Compound Name | 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol |
| PubChem CID | 167638393 |
| Molecular Formula | C26H23BrN2O4S2 |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol |
| SMILES | BrCc1ccccc1.O=[N+]([O-])c1ccc(S)cc1.O=[N+]([O-])c1ccc(SCc2ccccc2)cc1 |
| InChI | InChI=1S/C13H11NO2S.C7H7Br.C6H5NO2S/c15-14(16)12-6-8-13(9-7-12)17-10-11-4-2-1-3-5-11;8-6-7-4-2-1-3-5-7;8-7(9)5-1-3-6(10)4-2-5/h1-9H,10H2;1-5H,6H2;1-4,10H |
| InChIKey | OUPLFNHLQVLODD-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol?
The IUPAC name of 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol (CID 167638393) is 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol.
What is the SMILES notation for 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol?
The canonical SMILES for 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol is BrCc1ccccc1.O=[N+]([O-])c1ccc(S)cc1.O=[N+]([O-])c1ccc(SCc2ccccc2)cc1.
What is the InChIKey of 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol?
The InChIKey is OUPLFNHLQVLODD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2S.C7H7Br.C6H5NO2S/c15-14(16)12-6-8-13(9-7-12)17-10-11-4-2-1-3-5-11;8-6-7-4-2-1-3-5-7;8-7(9)5-1-3-6(10)4-2-5/h1-9H,10H2;1-5H,6H2;1-4,10H.
What are the key properties of 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol?
1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol has a molecular weight of 571.52 g/mol, XLogP of 8.35, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylsulfanyl-4-nitrobenzene;bromomethylbenzene;4-nitrobenzenethiol is sourced from PubChem (CID 167638393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).