C12H17N3O5 — CID 167640955
8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide (PubChem CID 167640955) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide.
| Compound Name | 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide |
|---|---|
| PubChem CID | 167640955 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide |
| SMILES | O=C(CCCCCC(=O)NO)Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17N3O5/c16-9(4-2-1-3-5-10(17)15-20)6-8-7-13-12(19)14-11(8)18/h7,20H,1-6H2,(H,15,17)(H2,13,14,18,19) |
| InChIKey | RAVYGWXQVLINGL-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|