About 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide
8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide (PubChem CID 167640955) has the molecular formula C12H17N3O5
and a molecular weight of 283.28 g/mol. Its IUPAC name is 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide.
Molecular Properties
| Compound Name | 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide |
| PubChem CID | 167640955 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide |
| SMILES | O=C(CCCCCC(=O)NO)Cc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17N3O5/c16-9(4-2-1-3-5-10(17)15-20)6-8-7-13-12(19)14-11(8)18/h7,20H,1-6H2,(H,15,17)(H2,13,14,18,19) |
| InChIKey | RAVYGWXQVLINGL-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide?
The IUPAC name of 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide (CID 167640955) is 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide.
What is the SMILES notation for 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide?
The canonical SMILES for 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide is O=C(CCCCCC(=O)NO)Cc1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide?
The InChIKey is RAVYGWXQVLINGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O5/c16-9(4-2-1-3-5-10(17)15-20)6-8-7-13-12(19)14-11(8)18/h7,20H,1-6H2,(H,15,17)(H2,13,14,18,19).
What are the key properties of 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide?
8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide has a molecular weight of 283.28 g/mol, XLogP of -0.37, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,4-dioxo-1H-pyrimidin-5-yl)-N-hydroxy-7-oxooctanamide is sourced from PubChem (CID 167640955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).