C17H15FN4O2S — CID 16764335
6-(4-fluorophenyl)-1-(furan-2-ylmethyl)-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one (PubChem CID 16764335) has the molecular formula C17H15FN4O2S and a molecular weight of 358.40 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1-(furan-2-ylmethyl)-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one.
| Compound Name | 6-(4-fluorophenyl)-1-(furan-2-ylmethyl)-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 16764335 |
| Molecular Formula | C17H15FN4O2S |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 6-(4-fluorophenyl)-1-(furan-2-ylmethyl)-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(Cc2ccco2)c2c1CN(c1ccc(F)cc1)CN2 |
| InChI | InChI=1S/C17H15FN4O2S/c18-11-3-5-12(6-4-11)21-9-14-15(19-10-21)22(17(25)20-16(14)23)8-13-2-1-7-24-13/h1-7,19H,8-10H2,(H,20,23,25) |
| InChIKey | XQHVMVYCAWVXEB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|