C9H10N2OS — CID 81339214
3-(furan-2-ylmethyl)-4-methyl-1H-imidazole-2-thione (PubChem CID 81339214) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-4-methyl-1H-imidazole-2-thione.
| Compound Name | 3-(furan-2-ylmethyl)-4-methyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81339214 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 3-(furan-2-ylmethyl)-4-methyl-1H-imidazole-2-thione |
| SMILES | Cc1c[nH]c(=S)n1Cc1ccco1 |
| InChI | InChI=1S/C9H10N2OS/c1-7-5-10-9(13)11(7)6-8-3-2-4-12-8/h2-5H,6H2,1H3,(H,10,13) |
| InChIKey | VIUUSPZRSRTMJY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|