C49H52N6O5 — CID 167645689
CID 167645689 (PubChem CID 167645689) has the molecular formula C49H52N6O5 and a molecular weight of 804.99 g/mol.
| Compound Name | CID 167645689 |
|---|---|
| PubChem CID | 167645689 |
| Molecular Formula | C49H52N6O5 |
| Molecular Weight | 804.99 g/mol |
| Exact Mass | 804.40 |
| IUPAC Name | — |
| SMILES | C=C1c2cccc(CCCCCNC(=O)c3ccc(NC(=O)[C@@H]4NC5(CCCCC5)[C@@]5(C(=O)Nc6ccccc65)[C@H]4c4ccccc4)cc3)c2CN1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C49H52N6O5/c1-31-36-18-13-17-32(37(36)30-55(31)40-25-26-41(56)53-45(40)58)14-7-3-12-29-50-44(57)34-21-23-35(24-22-34)51-46(59)43-42(33-15-5-2-6-16-33)49(48(54-43)27-10-4-11-28-48)38-19-8-9-20-39(38)52-47(49)60/h2,5-6,8-9,13,15-24,40,42-43,54H,1,3-4,7,10-12,14,25-30H2,(H,50,57)(H,51,59)(H,52,60)(H,53,56,58)/t40?,42-,43+,49+/m0/s1 |
| InChIKey | NYYVGOOQNDHBPM-HCGQGMJMSA-N |
| XLogP | 6.71 |
| TPSA | 148.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.99 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|