C50H50Cl2FN7O9 — CID 165030262
CID 165030262 (PubChem CID 165030262) has the molecular formula C50H50Cl2FN7O9 and a molecular weight of 982.89 g/mol.
| Compound Name | CID 165030262 |
|---|---|
| PubChem CID | 165030262 |
| Molecular Formula | C50H50Cl2FN7O9 |
| Molecular Weight | 982.89 g/mol |
| Exact Mass | 981.30 |
| IUPAC Name | — |
| SMILES | C=C(/C(F)=C(Cl)\C=C/C)[C@H]1[C@H](C(=O)Nc2ccc(C(=O)NCCCCNC(=O)COc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)cc2)NC2(CCCCC2)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C50H50Cl2FN7O9/c1-3-10-33(52)41(53)27(2)40-42(59-49(21-5-4-6-22-49)50(40)32-18-15-29(51)25-34(32)57-48(50)68)45(65)56-30-16-13-28(14-17-30)43(63)55-24-8-7-23-54-38(62)26-69-36-12-9-11-31-39(36)47(67)60(46(31)66)35-19-20-37(61)58-44(35)64/h3,9-18,25,35,40,42,59H,2,4-8,19-24,26H2,1H3,(H,54,62)(H,55,63)(H,56,65)(H,57,68)(H,58,61,64)/b10-3-,41-33-/t35?,40-,42+,50+/m0/s1 |
| InChIKey | MNRQCDCIHFBPIL-YDSWOJFASA-N |
| XLogP | 6.12 |
| TPSA | 221.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.89 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|