C14H11N5O — CID 16764606
N-phenyl-6-(1,2,4-triazol-4-yl)pyridine-3-carboxamide (PubChem CID 16764606) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is N-phenyl-6-(1,2,4-triazol-4-yl)pyridine-3-carboxamide.
| Compound Name | N-phenyl-6-(1,2,4-triazol-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16764606 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-phenyl-6-(1,2,4-triazol-4-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(-n2cnnc2)nc1 |
| InChI | InChI=1S/C14H11N5O/c20-14(18-12-4-2-1-3-5-12)11-6-7-13(15-8-11)19-9-16-17-10-19/h1-10H,(H,18,20) |
| InChIKey | CYWGMBINXFNNNG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |