C21H17F3N2O2 — CID 167646102
methyl 3-(2-amino-4-pyridinyl)-4-[[3-(trifluoromethyl)phenyl]methyl]benzoate (PubChem CID 167646102) has the molecular formula C21H17F3N2O2 and a molecular weight of 386.37 g/mol. Its IUPAC name is methyl 3-(2-amino-4-pyridinyl)-4-[[3-(trifluoromethyl)phenyl]methyl]benzoate.
| Compound Name | methyl 3-(2-amino-4-pyridinyl)-4-[[3-(trifluoromethyl)phenyl]methyl]benzoate |
|---|---|
| PubChem CID | 167646102 |
| Molecular Formula | C21H17F3N2O2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | methyl 3-(2-amino-4-pyridinyl)-4-[[3-(trifluoromethyl)phenyl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cc2cccc(C(F)(F)F)c2)c(-c2ccnc(N)c2)c1 |
| InChI | InChI=1S/C21H17F3N2O2/c1-28-20(27)16-6-5-14(18(11-16)15-7-8-26-19(25)12-15)9-13-3-2-4-17(10-13)21(22,23)24/h2-8,10-12H,9H2,1H3,(H2,25,26) |
| InChIKey | JPLAQJUEQYBTHI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |