C44H36F6N2O4 — CID 174214827
methyl 2-methyl-4-[4-[[3-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]benzoate (PubChem CID 174214827) has the molecular formula C44H36F6N2O4 and a molecular weight of 770.77 g/mol. Its IUPAC name is methyl 2-methyl-4-[4-[[3-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]benzoate.
| Compound Name | methyl 2-methyl-4-[4-[[3-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]benzoate |
|---|---|
| PubChem CID | 174214827 |
| Molecular Formula | C44H36F6N2O4 |
| Molecular Weight | 770.77 g/mol |
| Exact Mass | 770.26 |
| IUPAC Name | methyl 2-methyl-4-[4-[[3-(trifluoromethyl)phenyl]methyl]-2-pyridinyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(Cc3cccc(C(F)(F)F)c3)ccn2)cc1C.COC(=O)c1ccc(-c2cc(Cc3cccc(C(F)(F)F)c3)ccn2)cc1C |
| InChI | InChI=1S/2C22H18F3NO2/c2*1-14-10-17(6-7-19(14)21(27)28-2)20-13-16(8-9-26-20)11-15-4-3-5-18(12-15)22(23,24)25/h2*3-10,12-13H,11H2,1-2H3 |
| InChIKey | MYYOZPXJEGTXPB-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.77 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |